For research use only. Not for therapeutic Use.
2-Iodo-5-nitroaniline is an aromatic compound featuring an aniline structure with an iodine substituent at the 2-position and a nitro group at the 5-position. This unique arrangement enhances its electronic properties, making it valuable in organic synthesis and materials science. The nitro group can participate in electrophilic substitution reactions, while the iodine atom may facilitate nucleophilic attacks. This compound is potentially useful as an intermediate in the synthesis of pharmaceuticals and agrochemicals, as well as in the exploration of structure-activity relationships.
CAS Number | 5459-50-7 |
Molecular Formula | C6H5IN2O2 |
Purity | ≥95% |
IUPAC Name | 2-iodo-5-nitroaniline |
InChI | InChI=1S/C6H5IN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
InChIKey | VKQOHFHGWCXKOA-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)I |