For research use only. Not for therapeutic Use.
(2-Iodophenyl)hydrazine hydrochloride is an organoiodine compound featuring a hydrazine group linked to a 2-iodophenyl moiety. This compound is significant in organic synthesis, particularly for the preparation of various derivatives used in medicinal chemistry and material science. The presence of the iodine atom enhances its reactivity and facilitates the formation of diverse chemical structures. Research explores its potential applications in the synthesis of pharmaceuticals, agrochemicals, and as a building block in the development of bioactive compounds, highlighting its versatility in synthetic methodologies.
| Catalog Number | R073029 |
| CAS Number | 60481-34-7 |
| Molecular Formula | C6H8ClIN2 |
| Purity | ≥95% |
| IUPAC Name | (2-iodophenyl)hydrazine;hydrochloride |
| InChI | InChI=1S/C6H7IN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H |
| InChIKey | DLLUKLKKUJXLNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)I.Cl |
