For research use only. Not for therapeutic Use.
2-Isobutyrylcyclohexanone(CAT: L016090) is a high-purity aliphatic ketone widely utilized in pharmaceutical and chemical research. Featuring a cyclohexanone core with an isobutyryl substituent at the 2-position, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including bioactive compounds and specialty chemicals. Its unique structure and reactivity make it suitable for applications in medicinal chemistry, such as the development of therapeutic agents and agrochemicals. 2-Isobutyrylcyclohexanone ensures reliable performance, supporting innovative research in organic synthesis and advanced material development.
CAS Number | 39207-65-3 |
Molecular Formula | C10H16O2 |
Purity | ≥95% |
IUPAC Name | 2-(2-methylpropanoyl)cyclohexan-1-one |
InChI | InChI=1S/C10H16O2/c1-7(2)10(12)8-5-3-4-6-9(8)11/h7-8H,3-6H2,1-2H3 |
InChIKey | PFOYYSGBGILOQZ-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)C1CCCCC1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |