For research use only. Not for therapeutic Use.
2-Isopropyl-5-methoxyaniline (Cat.No:L003600) is a vital chemical compound widely used in pharmaceutical research and development. Its unique structure, featuring an isopropyl group and a methoxy substituent, grants it valuable pharmacological properties. This compound serves as a key intermediate in the synthesis of various pharmaceutical agents, highlighting its significance in drug discovery processes.
CAS Number | 1050514-20-9 |
Molecular Formula | C10H15NO |
Purity | ≥95% |
IUPAC Name | 5-methoxy-2-propan-2-ylaniline |
InChI | InChI=1S/C10H15NO/c1-7(2)9-5-4-8(12-3)6-10(9)11/h4-7H,11H2,1-3H3 |
InChIKey | WTIAXJRUKTYPOX-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C=C(C=C1)OC)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |