For research use only. Not for therapeutic Use.
2-Ketoglutaric acid-13C5(Cat No.:I041501)is a stable isotope-labeled form of 2-ketoglutaric acid, where five carbon atoms are replaced with the isotope carbon-13 (13C). This compound is commonly used in metabolic research and studies involving cellular respiration, amino acid metabolism, and the tricarboxylic acid (TCA) cycle. The incorporation of 13C allows researchers to track the metabolism and pathways of 2-ketoglutaric acid within biological systems using mass spectrometry or NMR techniques. It is useful for studying metabolic flux, enzyme activity, and cellular processes in health and disease.
CAS Number | 161096-83-9 |
Synonyms | 2-oxo(1,2,3,4,5-13C5)pentanedioic acid |
Molecular Formula | 13C5H6O5 |
Purity | ≥95% |
IUPAC Name | 2-oxo(1,2,3,4,5-13C5)pentanedioic acid |
InChI | InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/i1+1,2+1,3+1,4+1,5+1 |
InChIKey | KPGXRSRHYNQIFN-CVMUNTFWSA-N |
SMILES | [13CH2]([13CH2][13C](=O)O)[13C](=O)[13C](=O)O |