For research use only. Not for therapeutic Use.
2-Mercapto-1-phenylethanone(Cat No.:L006675), is a chemical compound with a distinctive molecular structure. It consists of a phenyl group attached to a carbon atom, which, in turn, is bonded to a ketone (ethanone) and a thiol (mercapto) group. Compounds like this one are valuable in organic synthesis due to their versatile reactivity. They serve as essential building blocks for creating complex molecules, often finding applications in the pharmaceutical and fragrance industries. Researchers utilize its unique chemical properties to develop various compounds, making it a key component in the synthesis of diverse chemical products.
CAS Number | 2462-02-4 |
Molecular Formula | C8H8OS |
Purity | ≥95% |
IUPAC Name | 1-phenyl-2-sulfanylethanone |
InChI | InChI=1S/C8H8OS/c9-8(6-10)7-4-2-1-3-5-7/h1-5,10H,6H2 |
InChIKey | DIYFBIOUBFTQJU-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)CS |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |