For research use only. Not for therapeutic Use.
2-Mercapto-5-nitrobenzimidazole is a heterocyclic compound featuring a benzimidazole core with a mercapto group at position 2 and a nitro group at position 5. It is widely used in pharmaceutical research and organic synthesis, particularly for developing bioactive molecules such as antifungal, antibacterial, and antiparasitic agents. Its sulfur-containing mercapto group and electron-withdrawing nitro group provide unique reactivity, making it valuable in drug discovery and the creation of enzyme inhibitors. This compound supports advancements in medicinal chemistry and therapeutic development.
CAS Number | 6325-91-3 |
Molecular Formula | C7H5N3O2S |
Purity | ≥95% |
IUPAC Name | 5-nitro-1,3-dihydrobenzimidazole-2-thione |
InChI | InChI=1S/C7H5N3O2S/c11-10(12)4-1-2-5-6(3-4)9-7(13)8-5/h1-3H,(H2,8,9,13) |
InChIKey | YPXQSGWOGQPLQO-UHFFFAOYSA-N |