For research use only. Not for therapeutic Use.
2-Mercaptopropanol(Cat No.:L007163), is a chemical compound with the molecular formula C3H8OS. Also known as 2-isopropanol, it contains a thiol (-SH) group attached to the second carbon of a three-carbon propane chain. This compound is utilized in various applications, including as a reducing agent in chemical reactions, a corrosion inhibitor, and a building block in the synthesis of pharmaceuticals and agrochemicals. Its thiol functionality allows it to participate in thiol-disulfide exchange reactions, making it important in organic synthesis, particularly in the creation of sulfur-containing compounds, contributing significantly to the field of chemical research and industrial applications.
CAS Number | 3001-64-7 |
Molecular Formula | C3H8OS |
Purity | ≥95% |
IUPAC Name | 2-sulfanylpropan-1-ol |
InChI | InChI=1S/C3H8OS/c1-3(5)2-4/h3-5H,2H2,1H3 |
InChIKey | QNNVICQPXUUBSN-UHFFFAOYSA-N |
SMILES | CC(CO)S |