For research use only. Not for therapeutic Use.
2-Mercaptopyridine N-Oxide Sodium Salt(Cat No.:R043172)is a versatile chemical compound widely used in pharmaceutical and biochemical research. As a sodium salt derivative of 2-mercaptopyridine N-oxide, it plays a crucial role in various applications, including the synthesis of metal complexes and as a ligand in coordination chemistry. This compound is also useful in the development of biologically active molecules, particularly in studies related to enzyme inhibition and the modulation of metabolic pathways. With its unique chemical properties, 2-Mercaptopyridine N-Oxide Sodium Salt serves as an essential tool in both synthetic chemistry and bioanalytical research.
CAS Number | 3811-73-2 |
Synonyms | 2-Pyridinethiol 1-Oxide Sodium Salt (1:1); ?2-Pyridinethiol 1-Oxide Sodium Deriv.; 2-Pyridinethiol 1-Oxide Sodium Salt; Sodium (2-pyridylthio)-N-oxide; 1-Oxo-2-pyridinethiol Sodium Salt; 2-Mercaptopyridine 1-Oxide Sodium Salt; 2-Mercaptopyridine N-ox |
Molecular Formula | C5H4NNaOS |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | sodium;1-oxidopyridine-2-thione |
InChI | InChI=1S/C5H4NOS.Na/c7-6-4-2-1-3-5(6)8;/h1-4H;/q-1;+1 |
InChIKey | XNRNJIIJLOFJEK-UHFFFAOYSA-N |
SMILES | C1=CC(=S)N(C=C1)[O-].[Na+] |
Reference | /Sodium Pyrithione./ MAK Collection for Occupational Health and Safety (2012): 1-25. Web.</span></p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |