For research use only. Not for therapeutic Use.
2-methoxy-1H-indole (Cat.No:L003458) is a crucial chemical compound in pharmaceutical research. Its indole core, coupled with a methoxy group, imparts distinctive pharmacological properties. This compound is integral in the synthesis of various bioactive molecules, underscoring its significance in drug discovery. Its structural motif makes it a valuable scaffold for the development of novel pharmaceutical agents, exemplifying its pivotal role in advancing medicinal chemistry.
Catalog Number | L003458 |
CAS Number | 1184915-80-7 |
Molecular Formula | C9H9NO |
Purity | ≥95% |
IUPAC Name | 2-methoxy-1H-indole |
InChI | InChI=1S/C9H9NO/c1-11-9-6-7-4-2-3-5-8(7)10-9/h2-6,10H,1H3 |
InChIKey | IKCZUPRWPVLSLF-UHFFFAOYSA-N |
SMILES | COC1=CC2=CC=CC=C2N1 |