For research use only. Not for therapeutic Use.
2-Methoxy-3-methylisonicotinic acid(CAT: L034309) is a high-purity heterocyclic carboxylic acid derivative featuring a methoxy group and a methyl substituent on the isonicotinic acid framework. This versatile molecule serves as a critical building block in pharmaceutical and chemical research, particularly in the synthesis of bioactive compounds, including anti-inflammatory agents and antimicrobial candidates. Its functionalized pyridine ring allows for targeted derivatization and structural modifications, enabling advanced chemical transformations. 2-Methoxy-3-methylisonicotinic acid combines excellent stability and reactivity, making it a valuable tool for medicinal chemistry, organic synthesis, and the development of innovative therapeutic and agrochemical applications.
CAS Number | 1211581-22-4 |
Molecular Formula | C8H9NO3 |
Purity | ≥95% |
IUPAC Name | 2-methoxy-3-methylpyridine-4-carboxylic acid |
InChI | InChI=1S/C8H9NO3/c1-5-6(8(10)11)3-4-9-7(5)12-2/h3-4H,1-2H3,(H,10,11) |
InChIKey | KFDYCRPBLIHWCR-UHFFFAOYSA-N |
SMILES | CC1=C(C=CN=C1OC)C(=O)O |