For research use only. Not for therapeutic Use.
22-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (Cat.No:L003568) is a significant chemical compound in pharmaceutical and materials research. Its unique structure incorporates a boron-containing moiety, enabling it to serve as a versatile reagent in cross-coupling reactions. This property is pivotal in the synthesis of specialized materials and pharmaceutical agents.
Catalog Number | L003568 |
CAS Number | 1220219-22-6 |
Molecular Formula | C14H18BNO3 |
Purity | ≥95% |
IUPAC Name | 2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
InChI | InChI=1S/C14H18BNO3/c1-13(2)14(3,4)19-15(18-13)11-6-7-12(17-5)10(8-11)9-16/h6-8H,1-5H3 |
InChIKey | SEQGLOXOYMXKLY-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)C#N |