For research use only. Not for therapeutic Use.
2-Methoxy-5-phenylpyridine(CAT: L035507) is a high-purity aromatic heterocyclic compound featuring a methoxy group at the 2-position and a phenyl group at the 5-position of the pyridine ring. This versatile molecule serves as a key building block in pharmaceutical research and synthetic organic chemistry, particularly for the development of bioactive compounds and complex heterocycles. Its structural features allow for targeted functionalization, enabling applications in medicinal chemistry, catalyst design, and material science. 2-Methoxy-5-phenylpyridine offers excellent stability and reactivity, making it an essential intermediate for innovative chemical synthesis and precision-driven research applications.
CAS Number | 53698-47-8 |
Molecular Formula | C12H11NO |
Purity | ≥95% |
IUPAC Name | 2-methoxy-5-phenylpyridine |
InChI | InChI=1S/C12H11NO/c1-14-12-8-7-11(9-13-12)10-5-3-2-4-6-10/h2-9H,1H3 |
InChIKey | QDCCBGFIBKJXNF-UHFFFAOYSA-N |
SMILES | COC1=NC=C(C=C1)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |