For research use only. Not for therapeutic Use.
2-Methoxy-5-(trifluoromethyl)aniline is an aromatic amine with a methoxy and a trifluoromethyl group on the benzene ring, frequently used in pharmaceutical and agrochemical synthesis. Its electron-donating methoxy group and electron-withdrawing trifluoromethyl group create a unique reactivity profile, making it valuable for developing bioactive compounds, including enzyme inhibitors and receptor modulators. This compound’s structure supports versatile chemical modifications, enhancing its utility in drug design, materials science, and organic synthesis, particularly where selective reactivity and stability are required.
Catalog Number | L018299 |
CAS Number | 349-65-5 |
Molecular Formula | C8H8F3NO |
Purity | ≥95% |
IUPAC Name | 2-methoxy-5-(trifluoromethyl)aniline |
InChI | InChI=1S/C8H8F3NO/c1-13-7-3-2-5(4-6(7)12)8(9,10)11/h2-4H,12H2,1H3 |
InChIKey | RKUSRLUGUVDNKP-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)C(F)(F)F)N |