Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine
For research use only. Not for therapeutic Use.
2-Methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine(CAT: L000316) plays a vital role in pharmaceutical chemistry. This chemical acts as a key intermediate in the synthesis of pharmaceutical compounds. Its primary use is in the development of novel drugs targeting various biological pathways. Researchers employ its unique structure to design potential therapeutic agents for a range of medical conditions, including neurological and cardiovascular disorders.
CAS Number | 676994-61-9 |
Molecular Formula | C9H12N2O |
Purity | ≥95% |
IUPAC Name | 2-methoxy-5,6,7,8-tetrahydro-1,6-naphthyridine |
InChI | InChI=1S/C9H12N2O/c1-12-9-3-2-7-6-10-5-4-8(7)11-9/h2-3,10H,4-6H2,1H3 |
InChIKey | ZHZTZWVJINYMGW-UHFFFAOYSA-N |