For research use only. Not for therapeutic Use.
2-Methoxy-6-methylpyridine-3-boronic acid(Cat No.:L033729)is a boronic acid derivative of a substituted pyridine, featuring a methoxy and a methyl group on the pyridine ring. This molecular structure is particularly useful in Suzuki-Miyaura cross-coupling reactions, a staple in organic synthesis for forming biaryl compounds, which are prevalent in pharmaceuticals and electronic materials. The boronic acid group facilitates these coupling reactions, while the methoxy and methyl groups modify the electronic properties of the ring, enhancing reactivity and solubility. This compound is essential for synthesizing complex molecules with precise pharmacological or electronic functions.
CAS Number | 1000802-75-4 |
Molecular Formula | C7H10BNO3 |
Purity | ≥95% |
IUPAC Name | (2-methoxy-6-methylpyridin-3-yl)boronic acid |
InChI | InChI=1S/C7H10BNO3/c1-5-3-4-6(8(10)11)7(9-5)12-2/h3-4,10-11H,1-2H3 |
InChIKey | FPYWLOGLINZGBB-UHFFFAOYSA-N |
SMILES | B(C1=C(N=C(C=C1)C)OC)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |