For research use only. Not for therapeutic Use.
2-Methoxy-N-(2-methoxyphenyl)benzimidamide (Cat.No:L003901) is a vital compound in pharmaceutical research. Its unique benzimidamide structure, coupled with methoxyphenyl groups, offers diverse reactivity. This compound holds promise in drug development, particularly in the field of medicinal chemistry. Its distinctive chemical properties make it a valuable candidate for the synthesis of novel pharmaceutical agents, highlighting its importance in the quest for innovative and effective therapeutics.
CAS Number | 524923-93-1 |
Molecular Formula | C15H16N2O2 |
Purity | ≥95% |
IUPAC Name | 2-methoxy-N'-(2-methoxyphenyl)benzenecarboximidamide |
InChI | InChI=1S/C15H16N2O2/c1-18-13-9-5-3-7-11(13)15(16)17-12-8-4-6-10-14(12)19-2/h3-10H,1-2H3,(H2,16,17) |
InChIKey | DRQKGHZNTXISPF-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1C(=NC2=CC=CC=C2OC)N |