For research use only. Not for therapeutic Use.
2-Methoxy-N, N-dimethylacetamide(Cat No.:L006986), is an organic compound characterized by its acetamide functional group (–CON(CH3)2) and methoxy group (–OCH3) attached to the carbon backbone. It is a clear, colorless liquid with a faint odor. This compound serves as a versatile solvent in various chemical processes, including pharmaceutical and polymer synthesis. Its unique combination of solubility and stability makes it valuable in the formulation of active pharmaceutical ingredients (APIs) and chemical reactions requiring controlled conditions.
Catalog Number | L006986 |
CAS Number | 4128-76-1 |
Molecular Formula | C5H11NO2 |
Purity | ≥95% |
IUPAC Name | 2-methoxy-N,N-dimethylacetamide |
InChI | InChI=1S/C5H11NO2/c1-6(2)5(7)4-8-3/h4H2,1-3H3 |
InChIKey | DZLUPKIRNOCKJB-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)COC |