For research use only. Not for therapeutic Use.
2-Methoxy Propane (CAT: R042393) is a common organic ether compound used as a solvent or organic synthesis reagent for the synthesis of pharmaceutical intermediates. This product is used in organic synthesis, pharmaceutical research and development, and other scientific research fields.
| Catalog Number | R042393 |
| CAS Number | 598-53-8 |
| Synonyms | 2-Methoxypropane; 2-Propylmethyl ether; Isopropyl Methyl Ether; Isopryl; Methyl Iso-propyl Ether; Methyl isopropyl Ether |
| Molecular Formula | C4H10O |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 2-methoxypropane |
| InChI | InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3 |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| SMILES | CC(C)OC |
