For research use only. Not for therapeutic Use.
2-(Methoxycarbonyl)-5-nitro-1H-pyrrole(Cat No.:M132481)is a crucial intermediate in the synthesis of complex organic molecules, particularly in pharmaceutical research. Its structure, which includes a methoxycarbonyl group and a nitro group attached to a pyrrole ring, makes it an essential building block for creating bioactive compounds. This compound is often used in the development of drugs targeting various biological pathways, including enzyme inhibition and receptor modulation. Its reactivity and versatility make it a valuable tool in the synthesis of novel therapeutic agents and other advanced chemical products.
CAS Number | 13138-73-3 |
Molecular Formula | C6H6N2O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | methyl 5-nitro-1H-pyrrole-2-carboxylate |
InChI | InChI=1S/C6H6N2O4/c1-12-6(9)4-2-3-5(7-4)8(10)11/h2-3,7H,1H3 |
InChIKey | ROJHSLVRAQKAKW-UHFFFAOYSA-N |
SMILES | COC(=O)C1=CC=C(N1)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |