For research use only. Not for therapeutic Use.
2-Methoxycyclohexan-1-amine(Cat No.:L032853)is an organic compound used in pharmaceutical research and organic synthesis. This molecule features a cyclohexane ring with a methoxy group at the 2-position and an amine group at the 1-position, making it a valuable intermediate in the creation of complex bioactive molecules. It is often employed in the development of potential therapeutic agents, particularly in the synthesis of drugs targeting neurological or metabolic disorders. Its unique structure allows for diverse chemical modifications, supporting advanced research in medicinal chemistry and drug discovery.
CAS Number | 4342-43-2 |
Molecular Formula | C7H15NO |
Purity | ≥95% |
IUPAC Name | 2-methoxycyclohexan-1-amine |
InChI | InChI=1S/C7H15NO/c1-9-7-5-3-2-4-6(7)8/h6-7H,2-5,8H2,1H3 |
InChIKey | NBWFBXBZOBXMHO-UHFFFAOYSA-N |
SMILES | COC1CCCCC1N |