For research use only. Not for therapeutic Use.
2-(Methoxymethyl)phenol(Cat No.:L030713)is a high-purity compound commonly used in pharmaceutical research and organic synthesis. This methoxymethylated phenol is a valuable intermediate for developing bioactive molecules and complex aromatic compounds. Its structure allows for versatile applications, particularly in the synthesis of medicinal agents and fine chemicals. 2-(Methoxymethyl)phenol is essential for research focused on exploring new therapeutic candidates and optimizing synthetic pathways, providing reliable performance in advanced chemical synthesis and facilitating the development of novel pharmaceutical compounds.
CAS Number | 5635-98-3 |
Molecular Formula | C8H10O2 |
Purity | ≥95% |
IUPAC Name | 2-(methoxymethyl)phenol |
InChI | InChI=1S/C8H10O2/c1-10-6-7-4-2-3-5-8(7)9/h2-5,9H,6H2,1H3 |
InChIKey | SSICPQZWCDZSQA-UHFFFAOYSA-N |
SMILES | COCC1=CC=CC=C1O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |