For research use only. Not for therapeutic Use.
(2-Methoxyphenyl)-carbamic acid, 1,1-dimethyl ethyl ester is an organic compound used as an intermediate in pharmaceutical and chemical research. Its structure, featuring a methoxy-substituted phenyl group and a tert-butyl carbamate, makes it valuable for synthesizing bioactive molecules, especially in drug development. This compound is frequently employed in protecting groups for amines during synthesis processes, facilitating the creation of complex molecules. Its versatility contributes to advancements in medicinal chemistry and the development of therapeutic agents.
CAS Number | 154150-18-2 |
Molecular Formula | C12H17NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tert-butyl N-(2-methoxyphenyl)carbamate |
InChI | InChI=1S/C12H17NO3/c1-12(2,3)16-11(14)13-9-7-5-6-8-10(9)15-4/h5-8H,1-4H3,(H,13,14) |
InChIKey | DHSWMVURURVRDB-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)NC1=CC=CC=C1OC |