For research use only. Not for therapeutic Use.
2-Methoxyphenyl isocyanate (Cat.No:L003492) is a vital chemical compound used in the synthesis of pharmaceuticals and agrochemicals. Its isocyanate functional group enables it to participate in various reactions, making it a versatile building block in organic chemistry. Due to its reactivity and selectivity, this compound plays a crucial role in the development of specialized compounds with diverse applications, underscoring its significance in modern chemical research.
| Catalog Number | L003492 |
| CAS Number | 700-87-8 |
| Molecular Formula | C8H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-isocyanato-2-methoxybenzene |
| InChI | InChI=1S/C8H7NO2/c1-11-8-5-3-2-4-7(8)9-6-10/h2-5H,1H3 |
| InChIKey | SUVCZZADQDCIEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N=C=O |
