For research use only. Not for therapeutic Use.
2-Methoxyphenylhydrazine Hydrochloride（Cat No.:L002371）is an aromatic hydrazine derivative used in pharmaceutical research and organic synthesis. Featuring a methoxy group on the phenyl ring, this compound serves as a key intermediate in the synthesis of various bioactive molecules, including pharmaceuticals and agrochemicals. Its hydrochloride form enhances solubility and stability, making it particularly valuable in developing therapeutic agents, such as antiviral and anticancer drugs. 2-Methoxyphenylhydrazine Hydrochloride is a crucial building block for chemists working on innovative drug discovery and chemical research projects.
| Catalog Number | L002371 |
| CAS Number | 57396-67-5 |
| Molecular Formula | C7H11ClN2O |
| Purity | ≥95% |
| IUPAC Name | (2-methoxyphenyl)hydrazine;hydrochloride |
| InChI | InChI=1S/C7H10N2O.ClH/c1-10-7-5-3-2-4-6(7)9-8;/h2-5,9H,8H2,1H3;1H |
| InChIKey | HECSHXUNOVTAIJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NN.Cl |
