For research use only. Not for therapeutic Use.
2-Methoxypyridin-3-ol is an organic compound with the formula C6H7NO2. It consists of a pyridine ring (a six-membered nitrogen-containing aromatic ring) with a methoxy group (-OCH3) attached at the 2-position and a hydroxyl group (-OH) at the 3-position. This compound is of interest in organic synthesis and medicinal chemistry due to its potential bioactivity, including antimicrobial, antioxidant, or anti-inflammatory effects. It may serve as a building block for the synthesis of more complex molecules or as a ligand in coordination chemistry.
| Catalog Number | L023564 |
| CAS Number | 13472-83-8 |
| Molecular Formula | C6H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-methoxypyridin-3-ol |
| InChI | InChI=1S/C6H7NO2/c1-9-6-5(8)3-2-4-7-6/h2-4,8H,1H3 |
| InChIKey | RDBZAWZPZSBYDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=N1)O |
