For research use only. Not for therapeutic Use.
2-Methoxythiophenol(Cat No.:R019418)is a sulfur-containing aromatic compound with a methoxy group attached to the benzene ring. This compound is valuable in chemical and pharmaceutical research, particularly as a building block for synthesizing more complex molecules. Its structure allows for versatile chemical reactions, making it useful in the development of new drugs and materials. 2-Methoxythiophenol is often employed in studies involving organic synthesis, catalysis, and the development of novel therapeutic agents, providing researchers with a reliable tool for advancing various scientific investigations.
CAS Number | 7217-59-6 |
Synonyms | 2-(Methoxy)benzothiol; 2-Mercaptoanisole; 2-Methoxybenzenethiol; 2-Methoxythiophenol; o-Methoxybenzenethiol; o-Methoxythiophenol |
Molecular Formula | C7H8OS |
Purity | ≥95% |
IUPAC Name | 2-methoxybenzenethiol |
InChI | InChI=1S/C7H8OS/c1-8-6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
InChIKey | DSCJETUEDFKYGN-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1S |