For research use only. Not for therapeutic Use.
2-Methoxyxanthen-9-one(Cat No.:M051301) is a chemical compound belonging to the xanthene class, which are tricyclic aromatic compounds. This particular derivative features a methoxy group attached at the second position and a ketone group at the ninth position of the xanthene ring. It appears as a crystalline solid and is primarily used in organic synthesis and as a photoinitiator in various industrial applications. The presence of the methoxy and ketone groups enhances its electronic properties, making it useful in the development of dyes, optical brighteners, and photodynamic therapy research.
CAS Number | 1214-20-6 |
Molecular Formula | C14H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methoxyxanthen-9-one |
InChI | InChI=1S/C14H10O3/c1-16-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)17-13/h2-8H,1H3 |
InChIKey | DVZCOQQFPCMIPO-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)OC3=CC=CC=C3C2=O |