For research use only. Not for therapeutic Use.
2-Methyl-1,10-phenanthroline(Cat No.:L027514)is a nitrogen-containing heterocyclic compound widely used in coordination chemistry, catalysis, and materials science. Featuring a phenanthroline core with a methyl group at the 2-position, this compound acts as an effective ligand in the formation of metal complexes. Its unique structure and electronic properties make it valuable in the synthesis of catalysts, organic light-emitting diodes (OLEDs), and other advanced materials. 2-Methyl-1,10-phenanthroline is essential for researchers developing innovative applications in catalysis, molecular electronics, and advanced material sciences.
Catalog Number | L027514 |
CAS Number | 3002-77-5 |
Molecular Formula | C13H10N2 |
Purity | ≥95% |
IUPAC Name | 2-methyl-1,10-phenanthroline |
InChI | InChI=1S/C13H10N2/c1-9-4-5-11-7-6-10-3-2-8-14-12(10)13(11)15-9/h2-8H,1H3 |
InChIKey | LQZDYPHFVGRHKD-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=CC3=C2N=CC=C3 |