For research use only. Not for therapeutic Use.
2-Methyl-1,2,3,4-tetrahydroquinoxaline(Cat No.:L007158), is a chemical compound. It is a bicyclic organic molecule containing a quinoxaline ring system with a methyl group at the 2nd position. This compound finds applications in medicinal chemistry and drug discovery research due to its structural versatility and potential biological activities. Tetrahydroquinoxalines serve as important scaffolds in the synthesis of various bioactive compounds, including pharmaceuticals and agrochemicals. Researchers utilize 2-Methyl-1,2,3,4-tetrahydroquinoxaline as a key intermediate in the development of novel drugs, contributing to advancements in therapeutic agents and chemical research related to human health and agriculture.
CAS Number | 6640-55-7 |
Molecular Formula | C9H12N2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-methyl-1,2,3,4-tetrahydroquinoxaline |
InChI | InChI=1S/C9H12N2/c1-7-6-10-8-4-2-3-5-9(8)11-7/h2-5,7,10-11H,6H2,1H3 |
InChIKey | PFGRBAYSEQEFQN-UHFFFAOYSA-N |
SMILES | CC1CNC2=CC=CC=C2N1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |