For research use only. Not for therapeutic Use.
2-Methyl-1,3-cyclopentanedione is a cyclic diketone characterized by a methyl group and two ketone functional groups on a five-membered ring. This compound is of interest in organic synthesis due to its reactivity, particularly in forming various derivatives through condensation reactions. It serves as a valuable building block in the production of fine chemicals, pharmaceuticals, and agrochemicals. Researchers explore its applications in designing novel compounds and its potential biological activities, contributing to advancements in synthetic organic chemistry and drug discovery.
CAS Number | 765-69-5 |
Synonyms | NSC 54458 |
Molecular Formula | C6H8O2 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | 2-methylcyclopentane-1,3-dione |
InChI | InChI=1S/C6H8O2/c1-4-5(7)2-3-6(4)8/h4H,2-3H2,1H3 |
InChIKey | HXZILEQYFQYQCE-UHFFFAOYSA-N |
SMILES | CC1C(=O)CCC1=O |