For research use only. Not for therapeutic Use.
2-Methyl-2-(1,3,5-dithiazinan-5-yl)ethanol（Cat No.:C000277）, is a chemical compound with a complex structure that includes a dithiazinan ring. Compounds like this often find applications in pharmaceutical research and organic synthesis. The presence of the dithiazinan ring suggests potential pharmacological activity or reactivity in chemical reactions. Researchers may use 2-Methyl-2-(1,3,5-dithiazinan-5-yl)ethanol as a building block or starting material to create new molecules with specific properties, or it may have unique characteristics that make it valuable for certain scientific investigations.
| Catalog Number | C000277 |
| CAS Number | 633336-01-3 |
| Synonyms | 2-(1,3,5-yl)isopropanol |
| Molecular Formula | C₆H₁₃NOS₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C, Inert atmosphere |
| IUPAC Name | 2-(1,3,5-dithiazinan-5-yl)propan-1-ol |
| InChI | InChI=1S/C6H13NOS2/c1-6(2-8)7-3-9-5-10-4-7/h6,8H,2-5H2,1H3 |
| InChIKey | GCGXVKORIWHXIY-UHFFFAOYSA-N |
| SMILES | CC(CO)N1CSCSC1 |
