Home
>
Reference Standards>Organic Building Blocks> 2-METHYL-2-THIAZOLINE-4-CARBOXYLIC ACID SODIUM SALT
For research use only. Not for therapeutic Use.
2-Methyl-2-thiazoline-4-carboxylic acid sodium salt is an organic compound used primarily as an intermediate in the synthesis of various chemicals, including pharmaceuticals and agrochemicals. The thiazoline ring structure provides a versatile platform for chemical modifications, making it useful in creating more complex molecules. The sodium salt form enhances the compound’s solubility in water, facilitating its use in aqueous reactions. This compound is often employed in research and development, particularly in the fields of medicinal chemistry and materials science, where it contributes to the synthesis of biologically active compounds.
CAS Number | 15058-19-2 |
Molecular Formula | C5H6NNaO2S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | sodium;2-methyl-4,5-dihydro-1,3-thiazole-4-carboxylate |
InChI | InChI=1S/C5H7NO2S.Na/c1-3-6-4(2-9-3)5(7)8;/h4H,2H2,1H3,(H,7,8);/q;+1/p-1 |
InChIKey | KDIYEJLRFZLXKU-UHFFFAOYSA-M |
SMILES | CC1=NC(CS1)C(=O)[O-].[Na+] |