For research use only. Not for therapeutic Use.
2-Methyl-3-buten-1-ol（Cat No.:M013166） is an organic compound, classified chemically as an unsaturated tertiary alcohol. This colorless liquid is characterized by a strong odor and is primarily used as an intermediate in the synthesis of other chemicals. Its structure features a double bond and a methyl group on an adjacent carbon, contributing to its reactivity and making it valuable in organic synthesis, particularly in the manufacture of fragrances, flavors, and pharmaceuticals. Additionally, 2-Methyl-3-buten-1-ol is utilized in the production of vitamins and as a building block in the polymer industry.
| Catalog Number | M013166 |
| CAS Number | 4516-90-9 |
| Molecular Formula | C5H10O |
| Purity | ≥95% |
| IUPAC Name | 2-methylbut-3-en-1-ol |
| InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h3,5-6H,1,4H2,2H3 |
| InChIKey | NVGOATMUHKIQQG-UHFFFAOYSA-N |
| SMILES | CC(CO)C=C |
