For research use only. Not for therapeutic Use.
2-Methyl-3-(methylthio)furan(Cat No.:L010691)is a sulfur-containing heterocyclic compound commonly used in flavor and fragrance industries due to its distinct aroma, often resembling roasted or caramelized notes. It features a methylthio group at the 3-position and a methyl group at the 2-position on the furan ring, which contributes to its unique olfactory properties. Additionally, 2-Methyl-3-(methylthio)furan is employed in chemical research for synthesizing more complex organic molecules, particularly in the development of flavor additives, perfumes, and other fine chemicals, enhancing sensory experiences in various applications.
CAS Number | 63012-97-5 |
Molecular Formula | C6H8OS |
Purity | ≥95% |
IUPAC Name | 2-methyl-3-methylsulfanylfuran |
InChI | InChI=1S/C6H8OS/c1-5-6(8-2)3-4-7-5/h3-4H,1-2H3 |
InChIKey | OQVAOEIMSKZGAL-UHFFFAOYSA-N |
SMILES | CC1=C(C=CO1)SC |