For research use only. Not for therapeutic Use.
2-Methyl-3-nitrobenzenesulfonyl chloride(Cat No.:L006774), is an organic compound. It features a sulfonamide functional group (-SO2Cl) attached to a nitrophenyl ring, with a methyl group at the 2-position. This compound is a versatile reagent in organic synthesis, used for introducing sulfonamide groups into various organic molecules. Its reactivity allows it to participate in diverse chemical transformations, making it valuable in the creation of complex molecules, including pharmaceutical intermediates and specialty chemicals. Researchers employ it as a key intermediate, contributing to advancements in medicinal chemistry and the synthesis of biologically active substances.
CAS Number | 56682-04-3 |
Molecular Formula | C7H6ClNO4S |
Purity | ≥95% |
IUPAC Name | 2-methyl-3-nitrobenzenesulfonyl chloride |
InChI | InChI=1S/C7H6ClNO4S/c1-5-6(9(10)11)3-2-4-7(5)14(8,12)13/h2-4H,1H3 |
InChIKey | SQIRQSKPXILWAM-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1S(=O)(=O)Cl)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |