For research use only. Not for therapeutic Use.
2-Methyl-4-isothiazolin-3-one Hydrochloride(Cat No.:R021662), is a biocidal compound widely used as a preservative in various industrial and consumer products. It exhibits broad-spectrum antimicrobial activity against bacteria, fungi, and other microorganisms, making it effective in preventing spoilage and contamination. With its solubility in water, it is suitable for water-based applications. 2-Methyl-4-isothiazolin-3-one Hydrochloride is commonly employed to ensure product stability and microbial control in various formulations.
Catalog Number | R021662 |
CAS Number | 26172-54-3 |
Synonyms | 2-Methyl-2H-isothiazol-3-one; 2-Methyl-3(2H)-isothiazolone Hydrochloride; 2-Methyl-3-isothiazolone Hydrochloride; 2-Methyl-4-isothiazolin-3-one Hydrochloride; 2-Methyl-4-isothiazoline-3-ketone Hydrochloride; 2-Methyl-4-isothiazoline-3-one Hydrochlori |
Molecular Formula | C4H6ClNOS |
Purity | ≥95% |
Target | Bacterial |
Storage | 2-8°C |
IUPAC Name | 2-methyl-1,2-thiazol-3-one;hydrochloride |
InChI | InChI=1S/C4H5NOS.ClH/c1-5-4(6)2-3-7-5;/h2-3H,1H3;1H |
InChIKey | SJXPQSRCFCPWQQ-UHFFFAOYSA-N |
SMILES | CN1C(=O)C=CS1.Cl |