For research use only. Not for therapeutic Use.
2-Methyl-4-isothiazolin-3-one(Cat No.:M015032), is a chemical compound commonly known as MIT or Methylisothiazolinone. It is a synthetic biocide and preservative used in various industrial and consumer products, such as paints, adhesives, personal care products (e.g., shampoos, lotions), and household cleaners. MIT is effective in inhibiting the growth of bacteria, fungi, and algae, thereby preventing spoilage and degradation of products. However, it has been associated with skin sensitization and allergic reactions in some individuals, leading to its regulation in certain applications.
CAS Number | 2682-20-4 |
Synonyms | 1-(4-CHLOROPHENYL)-3-(3,4-DICHLOROPHENYL)UREA;2-METHYL-4-ISOTHIAZOLIN-3-ONE;2-METHYL-4-ISOTHIAZOLINE-3-ONE;2-METHYL-3(2H)-ISOTHIAZOLONE;N-METHYL-3-OXODIHYDRO ISOTHIAZOLE;2-methyl-3(2h)-isothiazolon;Isothiazolone,2-methyl-;Methylisothiazolinone |
Molecular Formula | C4H5NOS |
Purity | ≥95% |
Target | Bacterial |
Storage | 2-8°C |
IUPAC Name | 2-methyl-1,2-thiazol-3-one |
InChI | InChI=1S/C4H5NOS/c1-5-4(6)2-3-7-5/h2-3H,1H3 |
InChIKey | BEGLCMHJXHIJLR-UHFFFAOYSA-N |
SMILES | CN1C(=O)C=CS1 |