For research use only. Not for therapeutic Use.
2-Methyl-4-nitroanisole is a key intermediate widely used in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. This compound features a methyl group and a nitro group attached to an anisole backbone, offering valuable reactivity in various chemical transformations. Its unique structure allows for selective modifications in complex molecule syntheses, making it essential for the development of active pharmaceutical ingredients and specialty chemicals. With its high purity and consistent performance, 2-Methyl-4-nitroanisole is a reliable choice for researchers and industries focusing on drug discovery, chemical synthesis, and material science.
Catalog Number | R004930 |
CAS Number | 50741-92-9 |
Synonyms | 4-Methoxy-3-methylnitrobenzene; 3-Methyl-4-methoxynitrobenzene; 2-Methoxy-5-nitrotoluene; 1-Methoxy-2-methyl-4-nitrobenzene; |
Molecular Formula | C8H9NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-methoxy-2-methyl-4-nitrobenzene |
InChI | InChI=1S/C8H9NO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5H,1-2H3 |
InChIKey | QOZMIJZYJZQOBV-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC |