For research use only. Not for therapeutic Use.
2-Methyl-4-propyl-1,3-oxathiane(CAT: L000147) is a compound of importance in organic chemistry. Its action mechanism involves serving as a key intermediate in various chemical reactions, making it valuable for the synthesis of complex organic molecules. This compound is essential for the development of various organic compounds and can be used as a building block for the creation of specialized molecules.
CAS Number | 67715-80-4 |
Molecular Formula | C8H16OS |
Purity | ≥95% |
IUPAC Name | 2-methyl-4-propyl-1,3-oxathiane |
InChI | InChI=1S/C8H16OS/c1-3-4-8-5-6-9-7(2)10-8/h7-8H,3-6H2,1-2H3 |
InChIKey | GKGOLPMYJJXRGD-UHFFFAOYSA-N |