For research use only. Not for therapeutic Use.
2-Methyl-5-(trifluoromethyl)benzaldehyde(CAT: L037735) is a high-purity aromatic compound featuring a methyl and trifluoromethyl group on a benzaldehyde backbone. This unique combination of functional groups makes it a valuable intermediate in pharmaceutical research, agrochemical synthesis, and material science. Its trifluoromethyl moiety enhances lipophilicity and metabolic stability, making it particularly useful in designing bioactive molecules, small-molecule inhibitors, and fluorinated drug candidates. Known for its chemical stability and versatile reactivity, 2-Methyl-5-(trifluoromethyl)benzaldehyde supports precision synthesis, enabling the development of advanced compounds for both academic and industrial research applications.
CAS Number | 886498-85-7 |
Molecular Formula | C9H7F3O |
Purity | ≥95% |
IUPAC Name | 2-methyl-5-(trifluoromethyl)benzaldehyde |
InChI | InChI=1S/C9H7F3O/c1-6-2-3-8(9(10,11)12)4-7(6)5-13/h2-5H,1H3 |
InChIKey | XFIZZVVBLXLTOD-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C(F)(F)F)C=O |