For research use only. Not for therapeutic Use.
2-Methyl-6-methylene-1,7-octadiene(Cat No.:M123848) is a chemical compound with a molecular formula C10H16. It is a colorless liquid with a strong odor and is used primarily as a flavor and fragrance ingredient. This compound occurs naturally in various plants and is responsible for the characteristic aroma of certain fruits and flowers. It is also used in the synthesis of perfumes and as a flavoring agent in food products. Additionally, 2-methyl-6-methylene-1,7-octadiene has applications in organic synthesis as a precursor to other compounds due to its unique chemical structure and reactivity.
CAS Number | 1686-30-2 |
Synonyms | 2-Methyl-6-methylene-1,7-octadiene |
Molecular Formula | C10H16 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-6-methylideneocta-1,7-diene |
InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5H,1-2,4,6-8H2,3H3 |
InChIKey | VYBREYKSZAROCT-UHFFFAOYSA-N |
SMILES | CC(=C)CCCC(=C)C=C |