For research use only. Not for therapeutic Use.
2-Methyl-6-nitro-1H-indole is a nitrogen-containing heterocyclic compound characterized by a methyl group at the 2-position and a nitro group at the 6-position of the indole ring. This unique structure enhances its reactivity and electronic properties, making it valuable in organic synthesis and medicinal chemistry. The nitro group can participate in electrophilic substitution reactions, while the methyl substituent may influence solubility and biological activity. This compound may serve as a key intermediate in the synthesis of pharmaceuticals and in exploring structure-activity relationships.
CAS Number | 3484-23-9 |
Molecular Formula | C9H8N2O2 |
Purity | ≥95% |
IUPAC Name | 2-methyl-6-nitro-1H-indole |
InChI | InChI=1S/C9H8N2O2/c1-6-4-7-2-3-8(11(12)13)5-9(7)10-6/h2-5,10H,1H3 |
InChIKey | QYRWLOIXPQRTLO-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(N1)C=C(C=C2)[N+](=O)[O-] |