For research use only. Not for therapeutic Use.
2-Methyl-N-[3-(trifluoromethyl)phenyl]propanamide is an organic compound featuring an amide group, a methyl group, and a trifluoromethyl-substituted phenyl ring. This structure imparts the compound with unique chemical properties, making it valuable in pharmaceutical and agrochemical research. The trifluoromethyl group enhances its lipophilicity and metabolic stability, contributing to potential biological activity. Researchers explore its applications in drug design, aiming to develop novel therapeutic agents by studying its interactions with biological targets and its role in structure-activity relationship studies.
CAS Number | 1939-27-1 |
Synonyms | α,α,α-Trifluoro-2-methyl-m-propionotoluidide |
Molecular Formula | C11H12F3NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-N-[3-(trifluoromethyl)phenyl]propanamide |
InChI | InChI=1S/C11H12F3NO/c1-7(2)10(16)15-9-5-3-4-8(6-9)11(12,13)14/h3-7H,1-2H3,(H,15,16) |
InChIKey | GETMKVRSDFVVHL-UHFFFAOYSA-N |
SMILES | CC(C)C(=O)NC1=CC=CC(=C1)C(F)(F)F |