For research use only. Not for therapeutic Use.
2-Methyl-oxetan-3-one, also known as propiolactone, is a cyclic organic compound featuring a four-membered oxetane ring with a ketone functional group. It serves as a versatile intermediate in organic synthesis, particularly in the production of pharmaceuticals, polymers, and fine chemicals. Its unique structure and reactivity enable various chemical transformations, making it valuable in the synthesis of diverse molecular structures.
CAS Number | 87385-83-9 |
Synonyms | 2-Methyl-3-oxetanone |
Molecular Formula | C4H6O2 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 2-methyloxetan-3-one |
InChI | InChI=1S/C4H6O2/c1-3-4(5)2-6-3/h3H,2H2,1H3 |
InChIKey | NOVNNMPBRZQLHL-UHFFFAOYSA-N |
SMILES | CC1C(=O)CO1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |