For research use only. Not for therapeutic Use.
2-((Methylamino)methyl)benzonitrile(Cat No.:L019330)is an organic compound featuring a benzonitrile group with a methylamino-methyl substituent at the 2-position. This compound is widely used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. Its structure allows for versatile reactivity, making it valuable in the development of complex molecules, particularly in medicinal chemistry. 2-((Methylamino)methyl)benzonitrile is essential for researchers and chemists working on the synthesis of bioactive compounds, offering high purity and reliable performance in various chemical transformations and research applications.
CAS Number | 860751-77-5 |
Molecular Formula | C9H10N2 |
Purity | ≥95% |
IUPAC Name | 2-(methylaminomethyl)benzonitrile |
InChI | InChI=1S/C9H10N2/c1-11-7-9-5-3-2-4-8(9)6-10/h2-5,11H,7H2,1H3 |
InChIKey | PUBJPAYRYCHLHO-UHFFFAOYSA-N |
SMILES | CNCC1=CC=CC=C1C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |