Home
>
Isotope Labeled Compounds>Isotope Labeled Synthetic Intermediates> 2-METHYLBUTANE-D12 (ISOPENTANE) 98
For research use only. Not for therapeutic Use.
2-Methylbutane-d12 is a fully deuterated version of 2-methylbutane, commonly known as isopentane. This compound, enhanced with twelve deuterium atoms, offers significant advantages for use in various scientific applications, particularly in spectroscopy and chemical research. The complete replacement of hydrogen atoms with deuterium increases the compound’s molecular stability and alters its physical properties, making it highly valuable in nuclear magnetic resonance (NMR) spectroscopy for obtaining clearer, more distinct spectral data. 2-Methylbutane-d12 is essential for researchers studying reaction mechanisms, kinetic isotope effects, or those conducting trace analysis in complex chemical systems, providing enhanced accuracy and detailed insights into molecular dynamics and interactions.
Catalog Number | M055082 |
CAS Number | 13351-96-7 |
Molecular Formula | (CD3)2CDCD2CD3 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 1,1,1,2,2,3,4,4,4-nonadeuterio-3-(trideuteriomethyl)butane |
InChI | InChI=1S/C5H12/c1-4-5(2)3/h5H,4H2,1-3H3/i1D3,2D3,3D3,4D2,5D |
InChIKey | QWTDNUCVQCZILF-WWKUACGSSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |