For research use only. Not for therapeutic Use.
2-Methyleicosane（Cat No.:M049231） is a high-purity hydrocarbon compound consisting of a methyl group attached to the second carbon of a 20-carbon linear alkane chain. Known for its role in organic synthesis and chemical research, it is often used as a reference standard in analytical chemistry, particularly in the study of lipid profiles and hydrocarbon analysis. Its stable structure and well-defined properties make it valuable in developing and calibrating chromatographic methods. 2-Methyleicosane also finds application in material science and industrial formulations, contributing to advancements in chemical analysis and product development.
| Catalog Number | M049231 |
| CAS Number | 1560-84-5 |
| Molecular Formula | C21H44 |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 2-methylicosane |
| InChI | InChI=1S/C21H44/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3/h21H,4-20H2,1-3H3 |
| InChIKey | MLKZKPUBHSWMNA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCCCCCC(C)C |
