For research use only. Not for therapeutic Use.
2-Methylfluorene(Cat No.:R022973)is an aromatic hydrocarbon commonly used in organic synthesis and material science. This compound features a fluorene backbone with a methyl group at the second position, making it valuable for producing polymers, pharmaceuticals, and organic electronic materials. Its unique structural properties contribute to the development of high-performance materials, including organic light-emitting diodes (OLEDs) and photovoltaic cells. High-purity 2-Methylfluorene ensures consistent performance and reliability in various research and industrial applications, making it a critical component for scientists and manufacturers in advanced material development.
Catalog Number | R022973 |
CAS Number | 1430-97-3 |
Synonyms | 2-Methyl-9H-fluorene; NSC 90365 |
Molecular Formula | C14H12 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-methyl-9H-fluorene |
InChI | InChI=1S/C14H12/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)14/h2-8H,9H2,1H3 |
InChIKey | RKJHJMAZNPASHY-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)C3=CC=CC=C3C2 |