For research use only. Not for therapeutic Use.
2-Methylindole-3-acetic acid(Cat No.:M123034)is a derivative of indole, a core structure in many biologically active molecules. Featuring a methyl group at the 2-position and an acetic acid group at the 3-position, this compound is widely used in pharmaceutical research and organic synthesis. It serves as a key intermediate in the development of bioactive compounds, including plant growth regulators and potential therapeutic agents. 2-Methylindole-3-acetic acid is valuable for researchers focused on creating novel compounds, exploring enzyme inhibitors, and advancing medicinal chemistry.
CAS Number | 1912-43-2 |
Molecular Formula | C11H11NO2 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-(2-methyl-1H-indol-3-yl)acetic acid |
InChI | InChI=1S/C11H11NO2/c1-7-9(6-11(13)14)8-4-2-3-5-10(8)12-7/h2-5,12H,6H2,1H3,(H,13,14) |
InChIKey | QJNNHJVSQUUHHE-UHFFFAOYSA-N |
SMILES | CC1=C(C2=CC=CC=C2N1)CC(=O)O |